About dimethylaminophosphanium
dimethylaminophosphanium (PubChem CID 22066094) has the molecular formula C2H9NP+
and a molecular weight of 78.07 g/mol. Its IUPAC name is dimethylaminophosphanium.
Molecular Properties
| Compound Name | dimethylaminophosphanium |
| PubChem CID | 22066094 |
| Molecular Formula | C2H9NP+ |
| Molecular Weight | 78.07 g/mol |
| Exact Mass | 78.05 |
| IUPAC Name | dimethylaminophosphanium |
| SMILES | CN(C)[PH3+] |
| InChI | InChI=1S/C2H8NP/c1-3(2)4/h4H2,1-2H3/p+1 |
| InChIKey | KCXYZMFPZHYUFO-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.07 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylaminophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylaminophosphanium?
The IUPAC name of dimethylaminophosphanium (CID 22066094) is dimethylaminophosphanium.
What is the SMILES notation for dimethylaminophosphanium?
The canonical SMILES for dimethylaminophosphanium is CN(C)[PH3+].
What is the InChIKey of dimethylaminophosphanium?
The InChIKey is KCXYZMFPZHYUFO-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H8NP/c1-3(2)4/h4H2,1-2H3/p+1.
What are the key properties of dimethylaminophosphanium?
dimethylaminophosphanium has a molecular weight of 78.07 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylaminophosphanium is sourced from PubChem (CID 22066094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).