C16H13NO4 — CID 22066099
3-(2,5-dimethyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 22066099) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-(2,5-dimethyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 22066099 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-(2,5-dimethyl-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc2[nH]c(C)c(C3=C(O)C(=O)C=C(O)C3=O)c2c1 |
| InChI | InChI=1S/C16H13NO4/c1-7-3-4-10-9(5-7)13(8(2)17-10)14-15(20)11(18)6-12(19)16(14)21/h3-6,17-18,21H,1-2H3 |
| InChIKey | FUZYMYOZBNSQQB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|