About azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide
azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 22066191) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 22066191 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O.N |
| InChI | InChI=1S/C11H17N3O3.H3N/c1-2-3-4-5-6-12-9(15)8-7-13-11(17)14-10(8)16;/h7H,2-6H2,1H3,(H,12,15)(H2,13,14,16,17);1H3 |
| InChIKey | HLAOPGAJAIBRBB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 129.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (CID 22066191) is azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is CCCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O.N.
What is the InChIKey of azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The InChIKey is HLAOPGAJAIBRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3.H3N/c1-2-3-4-5-6-12-9(15)8-7-13-11(17)14-10(8)16;/h7H,2-6H2,1H3,(H,12,15)(H2,13,14,16,17);1H3.
What are the key properties of azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide?
azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide has a molecular weight of 256.31 g/mol, XLogP of 0.54, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-hexyl-2,4-dioxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 22066191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).