About azepane-2,3,4,5-tetrone
azepane-2,3,4,5-tetrone (PubChem CID 22066352) has the molecular formula C6H5NO4
and a molecular weight of 155.11 g/mol. Its IUPAC name is azepane-2,3,4,5-tetrone.
Molecular Properties
| Compound Name | azepane-2,3,4,5-tetrone |
| PubChem CID | 22066352 |
| Molecular Formula | C6H5NO4 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | azepane-2,3,4,5-tetrone |
| SMILES | O=C1CCNC(=O)C(=O)C1=O |
| InChI | InChI=1S/C6H5NO4/c8-3-1-2-7-6(11)5(10)4(3)9/h1-2H2,(H,7,11) |
| InChIKey | LULGDMJJFMVANL-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azepane-2,3,4,5-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane-2,3,4,5-tetrone?
The IUPAC name of azepane-2,3,4,5-tetrone (CID 22066352) is azepane-2,3,4,5-tetrone.
What is the SMILES notation for azepane-2,3,4,5-tetrone?
The canonical SMILES for azepane-2,3,4,5-tetrone is O=C1CCNC(=O)C(=O)C1=O.
What is the InChIKey of azepane-2,3,4,5-tetrone?
The InChIKey is LULGDMJJFMVANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4/c8-3-1-2-7-6(11)5(10)4(3)9/h1-2H2,(H,7,11).
What are the key properties of azepane-2,3,4,5-tetrone?
azepane-2,3,4,5-tetrone has a molecular weight of 155.11 g/mol, XLogP of -1.79, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepane-2,3,4,5-tetrone is sourced from PubChem (CID 22066352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).