About azocane-2,3,4,5-tetrone
azocane-2,3,4,5-tetrone (PubChem CID 22066355) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is azocane-2,3,4,5-tetrone.
Molecular Properties
| Compound Name | azocane-2,3,4,5-tetrone |
| PubChem CID | 22066355 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | azocane-2,3,4,5-tetrone |
| SMILES | O=C1CCCNC(=O)C(=O)C1=O |
| InChI | InChI=1S/C7H7NO4/c9-4-2-1-3-8-7(12)6(11)5(4)10/h1-3H2,(H,8,12) |
| InChIKey | CPRWFFGLSXULMX-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azocane-2,3,4,5-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azocane-2,3,4,5-tetrone?
The IUPAC name of azocane-2,3,4,5-tetrone (CID 22066355) is azocane-2,3,4,5-tetrone.
What is the SMILES notation for azocane-2,3,4,5-tetrone?
The canonical SMILES for azocane-2,3,4,5-tetrone is O=C1CCCNC(=O)C(=O)C1=O.
What is the InChIKey of azocane-2,3,4,5-tetrone?
The InChIKey is CPRWFFGLSXULMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-4-2-1-3-8-7(12)6(11)5(4)10/h1-3H2,(H,8,12).
What are the key properties of azocane-2,3,4,5-tetrone?
azocane-2,3,4,5-tetrone has a molecular weight of 169.14 g/mol, XLogP of -1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azocane-2,3,4,5-tetrone is sourced from PubChem (CID 22066355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).