About N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide
N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide (PubChem CID 2206644) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide |
| PubChem CID | 2206644 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C13H18ClNO/c1-4-13(2,3)12(16)15-9-10-7-5-6-8-11(10)14/h5-8H,4,9H2,1-3H3,(H,15,16) |
| InChIKey | UOOYXTXCHSNWMI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide?
The IUPAC name of N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide (CID 2206644) is N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide.
What is the SMILES notation for N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide?
The canonical SMILES for N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide is CCC(C)(C)C(=O)NCc1ccccc1Cl.
What is the InChIKey of N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide?
The InChIKey is UOOYXTXCHSNWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-4-13(2,3)12(16)15-9-10-7-5-6-8-11(10)14/h5-8H,4,9H2,1-3H3,(H,15,16).
What are the key properties of N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide?
N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide has a molecular weight of 239.75 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)methyl]-2,2-dimethylbutanamide is sourced from PubChem (CID 2206644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).