C9H8N2O2 — CID 22068087
5-phenyl-3,4-dihydro-1,3,4-oxadiazin-2-one (PubChem CID 22068087) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 5-phenyl-3,4-dihydro-1,3,4-oxadiazin-2-one.
| Compound Name | 5-phenyl-3,4-dihydro-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 22068087 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 5-phenyl-3,4-dihydro-1,3,4-oxadiazin-2-one |
| SMILES | O=C1NNC(c2ccccc2)=CO1 |
| InChI | InChI=1S/C9H8N2O2/c12-9-11-10-8(6-13-9)7-4-2-1-3-5-7/h1-6,10H,(H,11,12) |
| InChIKey | KRNUNADKNBVIOQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |