About N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine
N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 22069275) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine |
| PubChem CID | 22069275 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCOC(C)NCCCN(CC)CC |
| InChI | InChI=1S/C11H26N2O/c1-5-13(6-2)10-8-9-12-11(4)14-7-3/h11-12H,5-10H2,1-4H3 |
| InChIKey | KRAAODHPUDYPSF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine?
The IUPAC name of N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine (CID 22069275) is N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine.
What is the SMILES notation for N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine?
The canonical SMILES for N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine is CCOC(C)NCCCN(CC)CC.
What is the InChIKey of N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine?
The InChIKey is KRAAODHPUDYPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O/c1-5-13(6-2)10-8-9-12-11(4)14-7-3/h11-12H,5-10H2,1-4H3.
What are the key properties of N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine?
N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine has a molecular weight of 202.34 g/mol, XLogP of 1.69, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethoxyethyl)-N',N'-diethylpropane-1,3-diamine is sourced from PubChem (CID 22069275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).