C19H20N6O3S3 — CID 2206972
1-[(4-ethyl-5-methylthiophene-3-carbonyl)amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 2206972) has the molecular formula C19H20N6O3S3 and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-[(4-ethyl-5-methylthiophene-3-carbonyl)amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[(4-ethyl-5-methylthiophene-3-carbonyl)amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2206972 |
| Molecular Formula | C19H20N6O3S3 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-[(4-ethyl-5-methylthiophene-3-carbonyl)amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | CCc1c(C(=O)NNC(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)csc1C |
| InChI | InChI=1S/C19H20N6O3S3/c1-3-15-12(2)30-11-16(15)17(26)23-24-19(29)22-13-5-7-14(8-6-13)31(27,28)25-18-20-9-4-10-21-18/h4-11H,3H2,1-2H3,(H,23,26)(H,20,21,25)(H2,22,24,29) |
| InChIKey | ZTEXLFKMBLKACY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|