C21H32ClN3O8 — CID 22071680
5-chloro-N-[3-(diethylamino)propyl]-2-(methylamino)benzamide;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 22071680) has the molecular formula C21H32ClN3O8 and a molecular weight of 489.95 g/mol. Its IUPAC name is 5-chloro-N-[3-(diethylamino)propyl]-2-(methylamino)benzamide;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 5-chloro-N-[3-(diethylamino)propyl]-2-(methylamino)benzamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 22071680 |
| Molecular Formula | C21H32ClN3O8 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 5-chloro-N-[3-(diethylamino)propyl]-2-(methylamino)benzamide;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)CCCNC(=O)c1cc(Cl)ccc1NC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24ClN3O.C6H8O7/c1-4-19(5-2)10-6-9-18-15(20)13-11-12(16)7-8-14(13)17-3;7-3(8)1-6(13,5(11)12)2-4(9)10/h7-8,11,17H,4-6,9-10H2,1-3H3,(H,18,20);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ZBUXKXMTHDPCCG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|