C11H20N2O2 — CID 22071889
N-ethyl-2-methylprop-2-enamide;N-ethylprop-2-enamide (PubChem CID 22071889) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-ethyl-2-methylprop-2-enamide;N-ethylprop-2-enamide.
| Compound Name | N-ethyl-2-methylprop-2-enamide;N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 22071889 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-ethyl-2-methylprop-2-enamide;N-ethylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCC.C=CC(=O)NCC |
| InChI | InChI=1S/C6H11NO.C5H9NO/c1-4-7-6(8)5(2)3;1-3-5(7)6-4-2/h2,4H2,1,3H3,(H,7,8);3H,1,4H2,2H3,(H,6,7) |
| InChIKey | QECVCTLNPYAVCC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|