C13H15ClFNO2S — CID 22073017
cyclopentyl 2-(5-amino-2-chloro-4-fluorophenyl)sulfanylacetate (PubChem CID 22073017) has the molecular formula C13H15ClFNO2S and a molecular weight of 303.79 g/mol. Its IUPAC name is cyclopentyl 2-(5-amino-2-chloro-4-fluorophenyl)sulfanylacetate.
| Compound Name | cyclopentyl 2-(5-amino-2-chloro-4-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 22073017 |
| Molecular Formula | C13H15ClFNO2S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | cyclopentyl 2-(5-amino-2-chloro-4-fluorophenyl)sulfanylacetate |
| SMILES | Nc1cc(SCC(=O)OC2CCCC2)c(Cl)cc1F |
| InChI | InChI=1S/C13H15ClFNO2S/c14-9-5-10(15)11(16)6-12(9)19-7-13(17)18-8-3-1-2-4-8/h5-6,8H,1-4,7,16H2 |
| InChIKey | XSCUYMFZUKDXDT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|