About quinoxaline-2,3-dione;hydrochloride
quinoxaline-2,3-dione;hydrochloride (PubChem CID 22073418) has the molecular formula C8H5ClN2O2
and a molecular weight of 196.59 g/mol. Its IUPAC name is quinoxaline-2,3-dione;hydrochloride.
Molecular Properties
| Compound Name | quinoxaline-2,3-dione;hydrochloride |
| PubChem CID | 22073418 |
| Molecular Formula | C8H5ClN2O2 |
| Molecular Weight | 196.59 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | quinoxaline-2,3-dione;hydrochloride |
| SMILES | Cl.O=C1N=c2ccccc2=NC1=O |
| InChI | InChI=1S/C8H4N2O2.ClH/c11-7-8(12)10-6-4-2-1-3-5(6)9-7;/h1-4H;1H |
| InChIKey | RSICBKMRKNZTAO-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.59 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze quinoxaline-2,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxaline-2,3-dione;hydrochloride?
The IUPAC name of quinoxaline-2,3-dione;hydrochloride (CID 22073418) is quinoxaline-2,3-dione;hydrochloride.
What is the SMILES notation for quinoxaline-2,3-dione;hydrochloride?
The canonical SMILES for quinoxaline-2,3-dione;hydrochloride is Cl.O=C1N=c2ccccc2=NC1=O.
What is the InChIKey of quinoxaline-2,3-dione;hydrochloride?
The InChIKey is RSICBKMRKNZTAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2.ClH/c11-7-8(12)10-6-4-2-1-3-5(6)9-7;/h1-4H;1H.
What are the key properties of quinoxaline-2,3-dione;hydrochloride?
quinoxaline-2,3-dione;hydrochloride has a molecular weight of 196.59 g/mol, XLogP of -0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxaline-2,3-dione;hydrochloride is sourced from PubChem (CID 22073418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).