C20H28N2O3S — CID 22074193
[2,5,7,8-tetramethyl-2-(piperazine-1-carbothioyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 22074193) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(piperazine-1-carbothioyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2,5,7,8-tetramethyl-2-(piperazine-1-carbothioyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 22074193 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(piperazine-1-carbothioyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(C(=S)N1CCNCC1)O2 |
| InChI | InChI=1S/C20H28N2O3S/c1-12-13(2)18-16(14(3)17(12)24-15(4)23)6-7-20(5,25-18)19(26)22-10-8-21-9-11-22/h21H,6-11H2,1-5H3 |
| InChIKey | MRNDELQMTBBRAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|