About 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol
7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol (PubChem CID 22074252) has the molecular formula C6H4O3
and a molecular weight of 124.09 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol.
Molecular Properties
| Compound Name | 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol |
| PubChem CID | 22074252 |
| Molecular Formula | C6H4O3 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol |
| SMILES | Oc1c(O)c2ccc1o2 |
| InChI | InChI=1S/C6H4O3/c7-5-3-1-2-4(9-3)6(5)8/h1-2,7-8H |
| InChIKey | UVSWHOIVIMUKOM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol?
The IUPAC name of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol (CID 22074252) is 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol.
What is the SMILES notation for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol?
The canonical SMILES for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol is Oc1c(O)c2ccc1o2.
What is the InChIKey of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol?
The InChIKey is UVSWHOIVIMUKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O3/c7-5-3-1-2-4(9-3)6(5)8/h1-2,7-8H.
What are the key properties of 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol?
7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol has a molecular weight of 124.09 g/mol, XLogP of 1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[2.2.1]hepta-1,3,5-triene-2,3-diol is sourced from PubChem (CID 22074252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).