C16H6O10 — CID 22074970
7-(2,4-dioxo-1,3,5-benzotrioxepin-7-yl)-1,3,5-benzotrioxepine-2,4-dione (PubChem CID 22074970) has the molecular formula C16H6O10 and a molecular weight of 358.21 g/mol. Its IUPAC name is 7-(2,4-dioxo-1,3,5-benzotrioxepin-7-yl)-1,3,5-benzotrioxepine-2,4-dione.
| Compound Name | 7-(2,4-dioxo-1,3,5-benzotrioxepin-7-yl)-1,3,5-benzotrioxepine-2,4-dione |
|---|---|
| PubChem CID | 22074970 |
| Molecular Formula | C16H6O10 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 7-(2,4-dioxo-1,3,5-benzotrioxepin-7-yl)-1,3,5-benzotrioxepine-2,4-dione |
| SMILES | O=C1OC(=O)Oc2cc(-c3ccc4c(c3)OC(=O)OC(=O)O4)ccc2O1 |
| InChI | InChI=1S/C16H6O10/c17-13-21-9-3-1-7(5-11(9)23-15(19)25-13)8-2-4-10-12(6-8)24-16(20)26-14(18)22-10/h1-6H |
| InChIKey | CIWZBDBYXODZLD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|