About N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine
N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 22075512) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine |
| PubChem CID | 22075512 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | COCCCNCC(C)CNC(C)C |
| InChI | InChI=1S/C11H26N2O/c1-10(2)13-9-11(3)8-12-6-5-7-14-4/h10-13H,5-9H2,1-4H3 |
| InChIKey | NDYMOVIHBDGPON-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The IUPAC name of N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine (CID 22075512) is N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine.
What is the SMILES notation for N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The canonical SMILES for N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine is COCCCNCC(C)CNC(C)C.
What is the InChIKey of N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
The InChIKey is NDYMOVIHBDGPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O/c1-10(2)13-9-11(3)8-12-6-5-7-14-4/h10-13H,5-9H2,1-4H3.
What are the key properties of N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine?
N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine has a molecular weight of 202.34 g/mol, XLogP of 1.25, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2-methyl-N'-propan-2-ylpropane-1,3-diamine is sourced from PubChem (CID 22075512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).