About 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane
4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane (PubChem CID 22076167) has the molecular formula C20H33ClO5S
and a molecular weight of 421.00 g/mol. Its IUPAC name is 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane.
Molecular Properties
| Compound Name | 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane |
| PubChem CID | 22076167 |
| Molecular Formula | C20H33ClO5S |
| Molecular Weight | 421.00 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane |
| SMILES | Cc1ccc(S(=O)(=O)CCCCOC2CCCCO2)cc1.OCCCCCl |
| InChI | InChI=1S/C16H24O4S.C4H9ClO/c1-14-7-9-15(10-8-14)21(17,18)13-5-4-12-20-16-6-2-3-11-19-16;5-3-1-2-4-6/h7-10,16H,2-6,11-13H2,1H3;6H,1-4H2 |
| InChIKey | PVMXKTGGUYBFEI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane?
The IUPAC name of 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane (CID 22076167) is 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane.
What is the SMILES notation for 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane?
The canonical SMILES for 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane is Cc1ccc(S(=O)(=O)CCCCOC2CCCCO2)cc1.OCCCCCl.
What is the InChIKey of 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane?
The InChIKey is PVMXKTGGUYBFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O4S.C4H9ClO/c1-14-7-9-15(10-8-14)21(17,18)13-5-4-12-20-16-6-2-3-11-19-16;5-3-1-2-4-6/h7-10,16H,2-6,11-13H2,1H3;6H,1-4H2.
What are the key properties of 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane?
4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane has a molecular weight of 421.00 g/mol, XLogP of 4.09, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobutan-1-ol;2-[4-(4-methylphenyl)sulfonylbutoxy]oxane is sourced from PubChem (CID 22076167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).