C14H13N3O3 — CID 22076450
methyl 2-carbamoyl-6-(pyridin-2-ylamino)benzoate (PubChem CID 22076450) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is methyl 2-carbamoyl-6-(pyridin-2-ylamino)benzoate.
| Compound Name | methyl 2-carbamoyl-6-(pyridin-2-ylamino)benzoate |
|---|---|
| PubChem CID | 22076450 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 2-carbamoyl-6-(pyridin-2-ylamino)benzoate |
| SMILES | COC(=O)c1c(Nc2ccccn2)cccc1C(N)=O |
| InChI | InChI=1S/C14H13N3O3/c1-20-14(19)12-9(13(15)18)5-4-6-10(12)17-11-7-2-3-8-16-11/h2-8H,1H3,(H2,15,18)(H,16,17) |
| InChIKey | DKVMNMQXYFBXNE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |