About (4-pentylcyclohexyl) hydrogen carbonate
(4-pentylcyclohexyl) hydrogen carbonate (PubChem CID 22076680) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (4-pentylcyclohexyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-pentylcyclohexyl) hydrogen carbonate |
| PubChem CID | 22076680 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (4-pentylcyclohexyl) hydrogen carbonate |
| SMILES | CCCCCC1CCC(OC(=O)O)CC1 |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-10-6-8-11(9-7-10)15-12(13)14/h10-11H,2-9H2,1H3,(H,13,14) |
| InChIKey | CICJVQMWAKQIBK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-pentylcyclohexyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentylcyclohexyl) hydrogen carbonate?
The IUPAC name of (4-pentylcyclohexyl) hydrogen carbonate (CID 22076680) is (4-pentylcyclohexyl) hydrogen carbonate.
What is the SMILES notation for (4-pentylcyclohexyl) hydrogen carbonate?
The canonical SMILES for (4-pentylcyclohexyl) hydrogen carbonate is CCCCCC1CCC(OC(=O)O)CC1.
What is the InChIKey of (4-pentylcyclohexyl) hydrogen carbonate?
The InChIKey is CICJVQMWAKQIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-3-4-5-10-6-8-11(9-7-10)15-12(13)14/h10-11H,2-9H2,1H3,(H,13,14).
What are the key properties of (4-pentylcyclohexyl) hydrogen carbonate?
(4-pentylcyclohexyl) hydrogen carbonate has a molecular weight of 214.30 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylcyclohexyl) hydrogen carbonate is sourced from PubChem (CID 22076680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).