C18H24ClN3O2S — CID 22077385
5-[5-(4-piperidin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]pentanoic acid;hydrochloride (PubChem CID 22077385) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is 5-[5-(4-piperidin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]pentanoic acid;hydrochloride.
| Compound Name | 5-[5-(4-piperidin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 22077385 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 5-[5-(4-piperidin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]pentanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCc1nnc(-c2ccc(C3CCNCC3)cc2)s1 |
| InChI | InChI=1S/C18H23N3O2S.ClH/c22-17(23)4-2-1-3-16-20-21-18(24-16)15-7-5-13(6-8-15)14-9-11-19-12-10-14;/h5-8,14,19H,1-4,9-12H2,(H,22,23);1H |
| InChIKey | QFBCXYGKZGIYMH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|