About diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate
diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate (PubChem CID 2207833) has the molecular formula C16H19F2NO5
and a molecular weight of 343.33 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate |
| PubChem CID | 2207833 |
| Molecular Formula | C16H19F2NO5 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1c(F)cccc1F)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H19F2NO5/c1-4-23-14(21)16(19-10(3)20,15(22)24-5-2)9-11-12(17)7-6-8-13(11)18/h6-8H,4-5,9H2,1-3H3,(H,19,20) |
| InChIKey | MTJPSPZSNACCJG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate?
The IUPAC name of diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate (CID 2207833) is diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate.
What is the SMILES notation for diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate?
The canonical SMILES for diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate is CCOC(=O)C(Cc1c(F)cccc1F)(NC(C)=O)C(=O)OCC.
What is the InChIKey of diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate?
The InChIKey is MTJPSPZSNACCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO5/c1-4-23-14(21)16(19-10(3)20,15(22)24-5-2)9-11-12(17)7-6-8-13(11)18/h6-8H,4-5,9H2,1-3H3,(H,19,20).
What are the key properties of diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate?
diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate has a molecular weight of 343.33 g/mol, XLogP of 1.51, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-acetamido-2-[(2,6-difluorophenyl)methyl]propanedioate is sourced from PubChem (CID 2207833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).