C20H29N3O5 — CID 22078367
[1-[[3-(4-aminophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidin-4-yl] tert-butyl carbonate (PubChem CID 22078367) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is [1-[[3-(4-aminophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidin-4-yl] tert-butyl carbonate.
| Compound Name | [1-[[3-(4-aminophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidin-4-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 22078367 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [1-[[3-(4-aminophenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]piperidin-4-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC1CCN(CC2CN(c3ccc(N)cc3)C(=O)O2)CC1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2,3)28-19(25)27-16-8-10-22(11-9-16)12-17-13-23(18(24)26-17)15-6-4-14(21)5-7-15/h4-7,16-17H,8-13,21H2,1-3H3 |
| InChIKey | CUQKYTHUALMRLV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|