About benzyl pyrrolidin-2-yl carbonate
benzyl pyrrolidin-2-yl carbonate (PubChem CID 22078377) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is benzyl pyrrolidin-2-yl carbonate.
Molecular Properties
| Compound Name | benzyl pyrrolidin-2-yl carbonate |
| PubChem CID | 22078377 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | benzyl pyrrolidin-2-yl carbonate |
| SMILES | O=C(OCc1ccccc1)OC1CCCN1 |
| InChI | InChI=1S/C12H15NO3/c14-12(16-11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2 |
| InChIKey | QPLHCGOJGMGGQE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl pyrrolidin-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl pyrrolidin-2-yl carbonate?
The IUPAC name of benzyl pyrrolidin-2-yl carbonate (CID 22078377) is benzyl pyrrolidin-2-yl carbonate.
What is the SMILES notation for benzyl pyrrolidin-2-yl carbonate?
The canonical SMILES for benzyl pyrrolidin-2-yl carbonate is O=C(OCc1ccccc1)OC1CCCN1.
What is the InChIKey of benzyl pyrrolidin-2-yl carbonate?
The InChIKey is QPLHCGOJGMGGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c14-12(16-11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-3,5-6,11,13H,4,7-9H2.
What are the key properties of benzyl pyrrolidin-2-yl carbonate?
benzyl pyrrolidin-2-yl carbonate has a molecular weight of 221.26 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl pyrrolidin-2-yl carbonate is sourced from PubChem (CID 22078377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).