C13H11F3O9S — CID 22079388
2-(4-methylphenyl)sulfonyloxy-3-(2,2,2-trifluoroacetyl)oxybutanedioic acid (PubChem CID 22079388) has the molecular formula C13H11F3O9S and a molecular weight of 400.28 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyloxy-3-(2,2,2-trifluoroacetyl)oxybutanedioic acid.
| Compound Name | 2-(4-methylphenyl)sulfonyloxy-3-(2,2,2-trifluoroacetyl)oxybutanedioic acid |
|---|---|
| PubChem CID | 22079388 |
| Molecular Formula | C13H11F3O9S |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyloxy-3-(2,2,2-trifluoroacetyl)oxybutanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC(C(=O)O)C(OC(=O)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C13H11F3O9S/c1-6-2-4-7(5-3-6)26(22,23)25-9(11(19)20)8(10(17)18)24-12(21)13(14,15)16/h2-5,8-9H,1H3,(H,17,18)(H,19,20) |
| InChIKey | WXLICRJHUZMVGA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|