C25H34F8O2 — CID 22080241
1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethyl]cyclohexa-1,4-diene (PubChem CID 22080241) has the molecular formula C25H34F8O2 and a molecular weight of 518.53 g/mol. Its IUPAC name is 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethyl]cyclohexa-1,4-diene.
| Compound Name | 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethyl]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 22080241 |
| Molecular Formula | C25H34F8O2 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1,3-difluoro-6-(1,1,2,3,3,3-hexafluoropropoxy)-3-[2-[4-[4-(methoxymethyl)cyclohexyl]cyclohexyl]ethyl]cyclohexa-1,4-diene |
| SMILES | COCC1CCC(C2CCC(CCC3(F)C=CC(OC(F)(F)C(F)C(F)(F)F)C(F)=C3)CC2)CC1 |
| InChI | InChI=1S/C25H34F8O2/c1-34-15-17-4-8-19(9-5-17)18-6-2-16(3-7-18)10-12-23(28)13-11-21(20(26)14-23)35-25(32,33)22(27)24(29,30)31/h11,13-14,16-19,21-22H,2-10,12,15H2,1H3 |
| InChIKey | ZKAIMEKARKGYNZ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|