About [2-(methylamino)-1,3-thiazol-5-yl]methanol
[2-(methylamino)-1,3-thiazol-5-yl]methanol (PubChem CID 22081017) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is [2-(methylamino)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(methylamino)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 22081017 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | [2-(methylamino)-1,3-thiazol-5-yl]methanol |
| SMILES | CNc1ncc(CO)s1 |
| InChI | InChI=1S/C5H8N2OS/c1-6-5-7-2-4(3-8)9-5/h2,8H,3H2,1H3,(H,6,7) |
| InChIKey | DMLMOVXBAYNDFI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(methylamino)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-(methylamino)-1,3-thiazol-5-yl]methanol (CID 22081017) is [2-(methylamino)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-(methylamino)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-(methylamino)-1,3-thiazol-5-yl]methanol is CNc1ncc(CO)s1.
What is the InChIKey of [2-(methylamino)-1,3-thiazol-5-yl]methanol?
The InChIKey is DMLMOVXBAYNDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS/c1-6-5-7-2-4(3-8)9-5/h2,8H,3H2,1H3,(H,6,7).
What are the key properties of [2-(methylamino)-1,3-thiazol-5-yl]methanol?
[2-(methylamino)-1,3-thiazol-5-yl]methanol has a molecular weight of 144.20 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 22081017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).