C8H7F3N2O2S — CID 22081035
N-ethyl-2,2,2-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)acetamide (PubChem CID 22081035) has the molecular formula C8H7F3N2O2S and a molecular weight of 252.22 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 22081035 |
| Molecular Formula | C8H7F3N2O2S |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-(5-formyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCN(C(=O)C(F)(F)F)c1ncc(C=O)s1 |
| InChI | InChI=1S/C8H7F3N2O2S/c1-2-13(6(15)8(9,10)11)7-12-3-5(4-14)16-7/h3-4H,2H2,1H3 |
| InChIKey | RPIOXEKWAXQKIT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|