C15H12F2N4O4 — CID 22081248
(E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine (PubChem CID 22081248) has the molecular formula C15H12F2N4O4 and a molecular weight of 350.28 g/mol. Its IUPAC name is (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine.
| Compound Name | (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 22081248 |
| Molecular Formula | C15H12F2N4O4 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (E)-1-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
| SMILES | CO/N=C(/C1=NOCCO1)c1ccccc1Oc1ncnc(F)c1F |
| InChI | InChI=1S/C15H12F2N4O4/c1-22-20-12(15-21-24-7-6-23-15)9-4-2-3-5-10(9)25-14-11(16)13(17)18-8-19-14/h2-5,8H,6-7H2,1H3/b20-12+ |
| InChIKey | BEOBOTIZZLEIAK-UDWIEESQSA-N |
| XLogP | 2.26 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|