About N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide
N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide (PubChem CID 22081425) has the molecular formula C9H11ClN4O3S
and a molecular weight of 290.73 g/mol. Its IUPAC name is N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide |
| PubChem CID | 22081425 |
| Molecular Formula | C9H11ClN4O3S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide |
| SMILES | CN(C=O)/C(=C\[N+](=O)[O-])N(C)Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H11ClN4O3S/c1-12(4-7-3-11-9(10)18-7)8(5-14(16)17)13(2)6-15/h3,5-6H,4H2,1-2H3/b8-5- |
| InChIKey | FJWSKTBOGBXUKT-YVMONPNESA-N |
| XLogP | 1.39 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide?
The IUPAC name of N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide (CID 22081425) is N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide.
What is the SMILES notation for N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide?
The canonical SMILES for N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide is CN(C=O)/C(=C\[N+](=O)[O-])N(C)Cc1cnc(Cl)s1.
What is the InChIKey of N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide?
The InChIKey is FJWSKTBOGBXUKT-YVMONPNESA-N. The full InChI is InChI=1S/C9H11ClN4O3S/c1-12(4-7-3-11-9(10)18-7)8(5-14(16)17)13(2)6-15/h3,5-6H,4H2,1-2H3/b8-5-.
What are the key properties of N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide?
N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide has a molecular weight of 290.73 g/mol, XLogP of 1.39, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-[(2-chloro-1,3-thiazol-5-yl)methyl-methylamino]-2-nitroethenyl]-N-methylformamide is sourced from PubChem (CID 22081425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).