C14H22O7 — CID 22081795
5,5,11,11-tetramethyl-7-(methylperoxymethyl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one (PubChem CID 22081795) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 5,5,11,11-tetramethyl-7-(methylperoxymethyl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one.
| Compound Name | 5,5,11,11-tetramethyl-7-(methylperoxymethyl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
|---|---|
| PubChem CID | 22081795 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5,5,11,11-tetramethyl-7-(methylperoxymethyl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
| SMILES | COOCC12CC3OC(C)(C)OC3C(=O)C1OC(C)(C)O2 |
| InChI | InChI=1S/C14H22O7/c1-12(2)18-8-6-14(7-17-16-5)11(9(15)10(8)19-12)20-13(3,4)21-14/h8,10-11H,6-7H2,1-5H3 |
| InChIKey | IVSQMFCPGUPUPI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|