C19H40N4 — CID 22081998
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine (PubChem CID 22081998) has the molecular formula C19H40N4 and a molecular weight of 324.56 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 22081998 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
| SMILES | CC1(C)CC(NCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H40N4/c1-16(2)9-14(10-17(3,4)22-16)20-13-21-15-11-18(5,6)23-19(7,8)12-15/h14-15,20-23H,9-13H2,1-8H3 |
| InChIKey | CZTDROUEFLBFKA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|