About [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone
[4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone (PubChem CID 2208228) has the molecular formula C28H17Cl2FN2O
and a molecular weight of 487.36 g/mol. Its IUPAC name is [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone |
| PubChem CID | 2208228 |
| Molecular Formula | C28H17Cl2FN2O |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ccc(-c2[nH]c(-c3ccc(Cl)cc3Cl)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H17Cl2FN2O/c29-21-12-15-23(24(30)16-21)28-32-25(17-4-2-1-3-5-17)26(33-28)18-6-8-19(9-7-18)27(34)20-10-13-22(31)14-11-20/h1-16H,(H,32,33) |
| InChIKey | NTXRWPOZHNSSOY-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone?
The IUPAC name of [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone (CID 2208228) is [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone.
What is the SMILES notation for [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone?
The canonical SMILES for [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)c1ccc(-c2[nH]c(-c3ccc(Cl)cc3Cl)nc2-c2ccccc2)cc1.
What is the InChIKey of [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone?
The InChIKey is NTXRWPOZHNSSOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17Cl2FN2O/c29-21-12-15-23(24(30)16-21)28-32-25(17-4-2-1-3-5-17)26(33-28)18-6-8-19(9-7-18)27(34)20-10-13-22(31)14-11-20/h1-16H,(H,32,33).
What are the key properties of [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone?
[4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone has a molecular weight of 487.36 g/mol, XLogP of 8.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,4-dichlorophenyl)-4-phenyl-1H-imidazol-5-yl]phenyl]-(4-fluorophenyl)methanone is sourced from PubChem (CID 2208228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).