About 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine
2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine (PubChem CID 22082542) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine |
| PubChem CID | 22082542 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine |
| SMILES | Cc1nc(C)c2c(n1)OCCC2 |
| InChI | InChI=1S/C9H12N2O/c1-6-8-4-3-5-12-9(8)11-7(2)10-6/h3-5H2,1-2H3 |
| InChIKey | NPMAKRRVFOUSLH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine?
The IUPAC name of 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine (CID 22082542) is 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine.
What is the SMILES notation for 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine?
The canonical SMILES for 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine is Cc1nc(C)c2c(n1)OCCC2.
What is the InChIKey of 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine?
The InChIKey is NPMAKRRVFOUSLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-8-4-3-5-12-9(8)11-7(2)10-6/h3-5H2,1-2H3.
What are the key properties of 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine?
2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine has a molecular weight of 164.21 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6,7-dihydro-5H-pyrano[2,3-d]pyrimidine is sourced from PubChem (CID 22082542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).