C21H27F3O6S — CID 22082715
(1R,2S,4R,5R,8R,9R,11R)-9-formyl-5-methyl-13-propan-2-yl-2-(trifluoromethylsulfonyloxymethyl)tetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 22082715) has the molecular formula C21H27F3O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is (1R,2S,4R,5R,8R,9R,11R)-9-formyl-5-methyl-13-propan-2-yl-2-(trifluoromethylsulfonyloxymethyl)tetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | (1R,2S,4R,5R,8R,9R,11R)-9-formyl-5-methyl-13-propan-2-yl-2-(trifluoromethylsulfonyloxymethyl)tetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22082715 |
| Molecular Formula | C21H27F3O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (1R,2S,4R,5R,8R,9R,11R)-9-formyl-5-methyl-13-propan-2-yl-2-(trifluoromethylsulfonyloxymethyl)tetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC(C)C1=C[C@H]2C[C@@]3(C=O)[C@@H]4CC[C@@H](C)[C@H]4C[C@@]2(COS(=O)(=O)C(F)(F)F)[C@]13C(=O)O |
| InChI | InChI=1S/C21H27F3O6S/c1-11(2)16-6-13-7-18(9-25)15-5-4-12(3)14(15)8-19(13,20(16,18)17(26)27)10-30-31(28,29)21(22,23)24/h6,9,11-15H,4-5,7-8,10H2,1-3H3,(H,26,27)/t12-,13+,14-,15-,18-,19+,20+/m1/s1 |
| InChIKey | YSLLFNNOPBRLGK-WLKSBDNNSA-N |
| XLogP | 3.78 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|