C17H25F2N3O — CID 22082970
5-(difluoromethoxy)-N-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 22082970) has the molecular formula C17H25F2N3O and a molecular weight of 325.40 g/mol. Its IUPAC name is 5-(difluoromethoxy)-N-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 5-(difluoromethoxy)-N-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 22082970 |
| Molecular Formula | C17H25F2N3O |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 5-(difluoromethoxy)-N-methyl-8-(4-methylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CNC1CCc2c(OC(F)F)ccc(N3CCN(C)CC3)c2C1 |
| InChI | InChI=1S/C17H25F2N3O/c1-20-12-3-4-13-14(11-12)15(5-6-16(13)23-17(18)19)22-9-7-21(2)8-10-22/h5-6,12,17,20H,3-4,7-11H2,1-2H3 |
| InChIKey | HDMJISAXSCITPD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|