C34H37ClN4O3 — CID 22083317
N-[1-(1-acetamidospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-(4-chlorophenyl)-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 22083317) has the molecular formula C34H37ClN4O3 and a molecular weight of 585.15 g/mol. Its IUPAC name is N-[1-(1-acetamidospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-(4-chlorophenyl)-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | N-[1-(1-acetamidospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-(4-chlorophenyl)-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22083317 |
| Molecular Formula | C34H37ClN4O3 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | N-[1-(1-acetamidospiro[1,2-dihydroindene-3,4'-piperidine]-1'-yl)-3-(4-chlorophenyl)-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CC(=O)NC1CC2(CCN(C(=O)C(Cc3ccc(Cl)cc3)NC(=O)C3Cc4ccccc4CN3)CC2)c2ccccc21 |
| InChI | InChI=1S/C34H37ClN4O3/c1-22(40)37-31-20-34(28-9-5-4-8-27(28)31)14-16-39(17-15-34)33(42)30(18-23-10-12-26(35)13-11-23)38-32(41)29-19-24-6-2-3-7-25(24)21-36-29/h2-13,29-31,36H,14-21H2,1H3,(H,37,40)(H,38,41) |
| InChIKey | BAINQJWLRLVVRM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |