C31H29N3O5S2 — CID 22083697
3-methyl-5-[(Z)-1-(4-methylperoxysulfanylphenyl)-2-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]ethenyl]-1,2,4-oxadiazole (PubChem CID 22083697) has the molecular formula C31H29N3O5S2 and a molecular weight of 587.72 g/mol. Its IUPAC name is 3-methyl-5-[(Z)-1-(4-methylperoxysulfanylphenyl)-2-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]ethenyl]-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-[(Z)-1-(4-methylperoxysulfanylphenyl)-2-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]ethenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 22083697 |
| Molecular Formula | C31H29N3O5S2 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 3-methyl-5-[(Z)-1-(4-methylperoxysulfanylphenyl)-2-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]ethenyl]-1,2,4-oxadiazole |
| SMILES | COOSc1ccc(/C(=C/c2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)c2nc(C)no2)cc1 |
| InChI | InChI=1S/C31H29N3O5S2/c1-20-33-30(38-34-20)28(22-11-13-26(14-12-22)40-39-37-4)17-21-8-6-9-23(16-21)27-19-25(31(2,3)41(5,35)36)18-24-10-7-15-32-29(24)27/h6-19H,1-5H3/b28-17- |
| InChIKey | SMQVVRJINGOMFY-QRQIAZFYSA-N |
| XLogP | 7.05 |
| TPSA | 104.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|