About N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+)
N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) (PubChem CID 22083951) has the molecular formula C5H10NO3SW+
and a molecular weight of 348.05 g/mol. Its IUPAC name is N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+).
Molecular Properties
| Compound Name | N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) |
| PubChem CID | 22083951 |
| Molecular Formula | C5H10NO3SW+ |
| Molecular Weight | 348.05 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) |
| SMILES | CCC([C-]=O)NS(C)(=O)=O.[W+2] |
| InChI | InChI=1S/C5H10NO3S.W/c1-3-5(4-7)6-10(2,8)9;/h5-6H,3H2,1-2H3;/q-1;+2 |
| InChIKey | IBOPRXFIWYJINZ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.05 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+)?
The IUPAC name of N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) (CID 22083951) is N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+).
What is the SMILES notation for N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+)?
The canonical SMILES for N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) is CCC([C-]=O)NS(C)(=O)=O.[W+2].
What is the InChIKey of N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+)?
The InChIKey is IBOPRXFIWYJINZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO3S.W/c1-3-5(4-7)6-10(2,8)9;/h5-6H,3H2,1-2H3;/q-1;+2.
What are the key properties of N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+)?
N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) has a molecular weight of 348.05 g/mol, XLogP of -0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-oxobutan-2-yl)methanesulfonamide;tungsten(2+) is sourced from PubChem (CID 22083951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).