C26H30F3NO3S — CID 22084161
1-[(8S,8aS)-8-phenyl-1,2,3,4,8,8a-hexahydronaphthalen-1-yl]-N-benzyl-N-methylmethanamine;trifluoromethanesulfonic acid (PubChem CID 22084161) has the molecular formula C26H30F3NO3S and a molecular weight of 493.59 g/mol. Its IUPAC name is 1-[(8S,8aS)-8-phenyl-1,2,3,4,8,8a-hexahydronaphthalen-1-yl]-N-benzyl-N-methylmethanamine;trifluoromethanesulfonic acid.
| Compound Name | 1-[(8S,8aS)-8-phenyl-1,2,3,4,8,8a-hexahydronaphthalen-1-yl]-N-benzyl-N-methylmethanamine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 22084161 |
| Molecular Formula | C26H30F3NO3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 1-[(8S,8aS)-8-phenyl-1,2,3,4,8,8a-hexahydronaphthalen-1-yl]-N-benzyl-N-methylmethanamine;trifluoromethanesulfonic acid |
| SMILES | CN(Cc1ccccc1)CC1CCCC2=CC=C[C@H](c3ccccc3)[C@H]21.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N.CHF3O3S/c1-26(18-20-10-4-2-5-11-20)19-23-16-8-14-22-15-9-17-24(25(22)23)21-12-6-3-7-13-21;2-1(3,4)8(5,6)7/h2-7,9-13,15,17,23-25H,8,14,16,18-19H2,1H3;(H,5,6,7)/t23?,24-,25-;/m1./s1 |
| InChIKey | YCORRNXCBAYSFF-ZHNZGCQSSA-N |
| XLogP | 6.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|