C42H59N3O15 — CID 22084345
2-[1,3-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]propoxy]propan-2-yloxy]propyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 22084345) has the molecular formula C42H59N3O15 and a molecular weight of 845.94 g/mol. Its IUPAC name is 2-[1,3-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]propoxy]propan-2-yloxy]propyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | 2-[1,3-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]propoxy]propan-2-yloxy]propyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 22084345 |
| Molecular Formula | C42H59N3O15 |
| Molecular Weight | 845.94 g/mol |
| Exact Mass | 845.39 |
| IUPAC Name | 2-[1,3-bis[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]propoxy]propan-2-yloxy]propyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | CC(COCC(COCC(C)OC(=O)CCCCCN1C(=O)C=CC1=O)OC(C)COC(=O)CCCCCN1C(=O)C=CC1=O)OC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C42H59N3O15/c1-30(59-41(53)14-8-5-11-23-44-36(48)18-19-37(44)49)25-55-28-33(58-32(3)27-57-40(52)13-7-4-10-22-43-34(46)16-17-35(43)47)29-56-26-31(2)60-42(54)15-9-6-12-24-45-38(50)20-21-39(45)51/h16-21,30-33H,4-15,22-29H2,1-3H3 |
| InChIKey | GZWZDJVYJOHBEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 218.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.94 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|