About [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate
[7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 22084358) has the molecular formula C21H26N2O7
and a molecular weight of 418.45 g/mol. Its IUPAC name is [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| PubChem CID | 22084358 |
| Molecular Formula | C21H26N2O7 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)COC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H26N2O7/c24-16(7-3-1-5-13-22-17(25)9-10-18(22)26)15-30-21(29)8-4-2-6-14-23-19(27)11-12-20(23)28/h9-12H,1-8,13-15H2 |
| InChIKey | SJAPEYZTCLEOOO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The IUPAC name of [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate (CID 22084358) is [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
What is the SMILES notation for [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The canonical SMILES for [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate is O=C(CCCCCN1C(=O)C=CC1=O)COC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The InChIKey is SJAPEYZTCLEOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O7/c24-16(7-3-1-5-13-22-17(25)9-10-18(22)26)15-30-21(29)8-4-2-6-14-23-19(27)11-12-20(23)28/h9-12H,1-8,13-15H2.
What are the key properties of [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate?
[7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate has a molecular weight of 418.45 g/mol, XLogP of 1.07, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,5-dioxopyrrol-1-yl)-2-oxoheptyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 22084358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).