C42H64N2O12 — CID 22084359
1-O-[9-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-7-methylnonyl] 6-O-[5-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-3-methylpentyl] hexanedioate (PubChem CID 22084359) has the molecular formula C42H64N2O12 and a molecular weight of 788.98 g/mol. Its IUPAC name is 1-O-[9-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-7-methylnonyl] 6-O-[5-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-3-methylpentyl] hexanedioate.
| Compound Name | 1-O-[9-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-7-methylnonyl] 6-O-[5-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-3-methylpentyl] hexanedioate |
|---|---|
| PubChem CID | 22084359 |
| Molecular Formula | C42H64N2O12 |
| Molecular Weight | 788.98 g/mol |
| Exact Mass | 788.45 |
| IUPAC Name | 1-O-[9-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-7-methylnonyl] 6-O-[5-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]-3-methylpentyl] hexanedioate |
| SMILES | CC(CCCCCCOC(=O)CCCCC(=O)OCCC(C)CCOC(=O)CCCCCN1C(=O)C=CC1=O)CCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C42H64N2O12/c1-33(24-30-54-40(50)16-8-5-12-27-43-35(45)20-21-36(43)46)15-7-3-4-14-29-53-39(49)18-10-11-19-42(52)56-32-26-34(2)25-31-55-41(51)17-9-6-13-28-44-37(47)22-23-38(44)48/h20-23,33-34H,3-19,24-32H2,1-2H3 |
| InChIKey | FUVNBSWQVKYUCU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.98 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|