C12H18O — CID 22084376
3-prop-2-enyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene (PubChem CID 22084376) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 3-prop-2-enyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | 3-prop-2-enyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 22084376 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3-prop-2-enyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene |
| SMILES | C=CCC1CCC2CC3OC3C2C1 |
| InChI | InChI=1S/C12H18O/c1-2-3-8-4-5-9-7-11-12(13-11)10(9)6-8/h2,8-12H,1,3-7H2 |
| InChIKey | JXUMLLHRUOCKKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|