C30H39N3O9 — CID 22084432
N-[[(4-benzoylbenzoyl)amino]methyl]-2-ethyl-2,4-dimethyl-N'-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanediamide (PubChem CID 22084432) has the molecular formula C30H39N3O9 and a molecular weight of 585.65 g/mol. Its IUPAC name is N-[[(4-benzoylbenzoyl)amino]methyl]-2-ethyl-2,4-dimethyl-N'-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanediamide.
| Compound Name | N-[[(4-benzoylbenzoyl)amino]methyl]-2-ethyl-2,4-dimethyl-N'-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanediamide |
|---|---|
| PubChem CID | 22084432 |
| Molecular Formula | C30H39N3O9 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | N-[[(4-benzoylbenzoyl)amino]methyl]-2-ethyl-2,4-dimethyl-N'-[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]pentanediamide |
| SMILES | CCC(C)(CC(C)C(=O)NC1C(O)OC(CO)C(O)C1O)C(=O)NCNC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H39N3O9/c1-4-30(3,14-17(2)26(38)33-22-25(37)24(36)21(15-34)42-28(22)40)29(41)32-16-31-27(39)20-12-10-19(11-13-20)23(35)18-8-6-5-7-9-18/h5-13,17,21-22,24-25,28,34,36-37,40H,4,14-16H2,1-3H3,(H,31,39)(H,32,41)(H,33,38) |
| InChIKey | MLIKMDXXYGKZJD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 194.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|