About 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid
7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid (PubChem CID 22085175) has the molecular formula C24H37F2NO5
and a molecular weight of 457.56 g/mol. Its IUPAC name is 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid |
| PubChem CID | 22085175 |
| Molecular Formula | C24H37F2NO5 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid |
| SMILES | CONC1CC(O)C(CCCCCCC(=O)O)C1CCC(O)CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H37F2NO5/c1-32-27-22-15-23(29)21(6-4-2-3-5-7-24(30)31)20(22)11-10-19(28)9-8-16-12-17(25)14-18(26)13-16/h12-14,19-23,27-29H,2-11,15H2,1H3,(H,30,31) |
| InChIKey | DHWYEERYRDVJTH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid?
The IUPAC name of 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid (CID 22085175) is 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid.
What is the SMILES notation for 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid?
The canonical SMILES for 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid is CONC1CC(O)C(CCCCCCC(=O)O)C1CCC(O)CCc1cc(F)cc(F)c1.
What is the InChIKey of 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid?
The InChIKey is DHWYEERYRDVJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37F2NO5/c1-32-27-22-15-23(29)21(6-4-2-3-5-7-24(30)31)20(22)11-10-19(28)9-8-16-12-17(25)14-18(26)13-16/h12-14,19-23,27-29H,2-11,15H2,1H3,(H,30,31).
What are the key properties of 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid?
7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid has a molecular weight of 457.56 g/mol, XLogP of 3.98, 15 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[5-(3,5-difluorophenyl)-3-hydroxypentyl]-5-hydroxy-3-(methoxyamino)cyclopentyl]heptanoic acid is sourced from PubChem (CID 22085175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).