About 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione
5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 22085288) has the molecular formula C8H9NS3
and a molecular weight of 215.37 g/mol. Its IUPAC name is 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
Molecular Properties
| Compound Name | 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| PubChem CID | 22085288 |
| Molecular Formula | C8H9NS3 |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C8H9NS3/c1-9-7(10)4-6-5(8(9)11)2-3-12-6/h4-5H,2-3H2,1H3 |
| InChIKey | DBMHXGIMODDVEH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The IUPAC name of 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (CID 22085288) is 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
What is the SMILES notation for 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The canonical SMILES for 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione is CN1C(=S)C=C2SCCC2C1=S.
What is the InChIKey of 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The InChIKey is DBMHXGIMODDVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS3/c1-9-7(10)4-6-5(8(9)11)2-3-12-6/h4-5H,2-3H2,1H3.
What are the key properties of 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione has a molecular weight of 215.37 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione is sourced from PubChem (CID 22085288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).