C33H50O2 — CID 22085523
[4-(6-methylheptyl)cyclohexen-1-yl] 4-[2-(4-butylcyclohexen-1-yl)ethyl]benzoate (PubChem CID 22085523) has the molecular formula C33H50O2 and a molecular weight of 478.76 g/mol. Its IUPAC name is [4-(6-methylheptyl)cyclohexen-1-yl] 4-[2-(4-butylcyclohexen-1-yl)ethyl]benzoate.
| Compound Name | [4-(6-methylheptyl)cyclohexen-1-yl] 4-[2-(4-butylcyclohexen-1-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 22085523 |
| Molecular Formula | C33H50O2 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | [4-(6-methylheptyl)cyclohexen-1-yl] 4-[2-(4-butylcyclohexen-1-yl)ethyl]benzoate |
| SMILES | CCCCC1CC=C(CCc2ccc(C(=O)OC3=CCC(CCCCCC(C)C)CC3)cc2)CC1 |
| InChI | InChI=1S/C33H50O2/c1-4-5-10-27-12-14-29(15-13-27)16-17-30-18-22-31(23-19-30)33(34)35-32-24-20-28(21-25-32)11-8-6-7-9-26(2)3/h14,18-19,22-24,26-28H,4-13,15-17,20-21,25H2,1-3H3 |
| InChIKey | XEGCYNBNEHPPKK-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|