About 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine
5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine (PubChem CID 22085768) has the molecular formula C32H24N2S
and a molecular weight of 468.63 g/mol. Its IUPAC name is 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine |
| PubChem CID | 22085768 |
| Molecular Formula | C32H24N2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine |
| SMILES | Cc1sc(C)c2nc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)nc12 |
| InChI | InChI=1S/C32H24N2S/c1-21-29-30(22(2)35-21)34-32(28-19-15-26(16-20-28)24-11-7-4-8-12-24)31(33-29)27-17-13-25(14-18-27)23-9-5-3-6-10-23/h3-20H,1-2H3 |
| InChIKey | FOHFBARAHWJNMV-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine?
The IUPAC name of 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine (CID 22085768) is 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine.
What is the SMILES notation for 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine?
The canonical SMILES for 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine is Cc1sc(C)c2nc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)nc12.
What is the InChIKey of 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine?
The InChIKey is FOHFBARAHWJNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24N2S/c1-21-29-30(22(2)35-21)34-32(28-19-15-26(16-20-28)24-11-7-4-8-12-24)31(33-29)27-17-13-25(14-18-27)23-9-5-3-6-10-23/h3-20H,1-2H3.
What are the key properties of 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine?
5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine has a molecular weight of 468.63 g/mol, XLogP of 8.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2,3-bis(4-phenylphenyl)thieno[3,4-b]pyrazine is sourced from PubChem (CID 22085768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).