About N,4-dihydroxypentanamide
N,4-dihydroxypentanamide (PubChem CID 22085887) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is N,4-dihydroxypentanamide.
Molecular Properties
| Compound Name | N,4-dihydroxypentanamide |
| PubChem CID | 22085887 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | N,4-dihydroxypentanamide |
| SMILES | CC(O)CCC(=O)NO |
| InChI | InChI=1S/C5H11NO3/c1-4(7)2-3-5(8)6-9/h4,7,9H,2-3H2,1H3,(H,6,8) |
| InChIKey | PRAQIBIUQMGZIR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,4-dihydroxypentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dihydroxypentanamide?
The IUPAC name of N,4-dihydroxypentanamide (CID 22085887) is N,4-dihydroxypentanamide.
What is the SMILES notation for N,4-dihydroxypentanamide?
The canonical SMILES for N,4-dihydroxypentanamide is CC(O)CCC(=O)NO.
What is the InChIKey of N,4-dihydroxypentanamide?
The InChIKey is PRAQIBIUQMGZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c1-4(7)2-3-5(8)6-9/h4,7,9H,2-3H2,1H3,(H,6,8).
What are the key properties of N,4-dihydroxypentanamide?
N,4-dihydroxypentanamide has a molecular weight of 133.15 g/mol, XLogP of -0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dihydroxypentanamide is sourced from PubChem (CID 22085887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).